About 4-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-5-methoxy-1H-pyrimidin-6-one
4-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-5-methoxy-1H-pyrimidin-6-one (PubChem CID 136973601) has the molecular formula C12H22N4O2
and a molecular weight of 254.33 g/mol. Its IUPAC name is 4-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-5-methoxy-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-5-methoxy-1H-pyrimidin-6-one |
| PubChem CID | 136973601 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 4-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-5-methoxy-1H-pyrimidin-6-one |
| SMILES | COc1c(NCC(C)(C)CN(C)C)nc[nH]c1=O |
| InChI | InChI=1S/C12H22N4O2/c1-12(2,7-16(3)4)6-13-10-9(18-5)11(17)15-8-14-10/h8H,6-7H2,1-5H3,(H2,13,14,15,17) |
| InChIKey | WRICQNOQZFMHDO-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-5-methoxy-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-5-methoxy-1H-pyrimidin-6-one?
The IUPAC name of 4-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-5-methoxy-1H-pyrimidin-6-one (CID 136973601) is 4-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-5-methoxy-1H-pyrimidin-6-one.
What is the SMILES notation for 4-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-5-methoxy-1H-pyrimidin-6-one?
The canonical SMILES for 4-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-5-methoxy-1H-pyrimidin-6-one is COc1c(NCC(C)(C)CN(C)C)nc[nH]c1=O.
What is the InChIKey of 4-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-5-methoxy-1H-pyrimidin-6-one?
The InChIKey is WRICQNOQZFMHDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4O2/c1-12(2,7-16(3)4)6-13-10-9(18-5)11(17)15-8-14-10/h8H,6-7H2,1-5H3,(H2,13,14,15,17).
What are the key properties of 4-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-5-methoxy-1H-pyrimidin-6-one?
4-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-5-methoxy-1H-pyrimidin-6-one has a molecular weight of 254.33 g/mol, XLogP of 0.78, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-5-methoxy-1H-pyrimidin-6-one is sourced from PubChem (CID 136973601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).