About 5-amino-4-(2,2,2-trifluoroethylamino)-1H-pyrimidin-6-one
5-amino-4-(2,2,2-trifluoroethylamino)-1H-pyrimidin-6-one (PubChem CID 136973712) has the molecular formula C6H7F3N4O
and a molecular weight of 208.14 g/mol. Its IUPAC name is 5-amino-4-(2,2,2-trifluoroethylamino)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-amino-4-(2,2,2-trifluoroethylamino)-1H-pyrimidin-6-one |
| PubChem CID | 136973712 |
| Molecular Formula | C6H7F3N4O |
| Molecular Weight | 208.14 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 5-amino-4-(2,2,2-trifluoroethylamino)-1H-pyrimidin-6-one |
| SMILES | Nc1c(NCC(F)(F)F)nc[nH]c1=O |
| InChI | InChI=1S/C6H7F3N4O/c7-6(8,9)1-11-4-3(10)5(14)13-2-12-4/h2H,1,10H2,(H2,11,12,13,14) |
| InChIKey | RUPYDSGUKXMYKA-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.14 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-4-(2,2,2-trifluoroethylamino)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-(2,2,2-trifluoroethylamino)-1H-pyrimidin-6-one?
The IUPAC name of 5-amino-4-(2,2,2-trifluoroethylamino)-1H-pyrimidin-6-one (CID 136973712) is 5-amino-4-(2,2,2-trifluoroethylamino)-1H-pyrimidin-6-one.
What is the SMILES notation for 5-amino-4-(2,2,2-trifluoroethylamino)-1H-pyrimidin-6-one?
The canonical SMILES for 5-amino-4-(2,2,2-trifluoroethylamino)-1H-pyrimidin-6-one is Nc1c(NCC(F)(F)F)nc[nH]c1=O.
What is the InChIKey of 5-amino-4-(2,2,2-trifluoroethylamino)-1H-pyrimidin-6-one?
The InChIKey is RUPYDSGUKXMYKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7F3N4O/c7-6(8,9)1-11-4-3(10)5(14)13-2-12-4/h2H,1,10H2,(H2,11,12,13,14).
What are the key properties of 5-amino-4-(2,2,2-trifluoroethylamino)-1H-pyrimidin-6-one?
5-amino-4-(2,2,2-trifluoroethylamino)-1H-pyrimidin-6-one has a molecular weight of 208.14 g/mol, XLogP of 0.33, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-(2,2,2-trifluoroethylamino)-1H-pyrimidin-6-one is sourced from PubChem (CID 136973712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).