C9H12ClN3O2 — CID 136973800
5-chloro-4-(oxolan-2-ylmethylamino)-1H-pyrimidin-6-one (PubChem CID 136973800) has the molecular formula C9H12ClN3O2 and a molecular weight of 229.67 g/mol. Its IUPAC name is 5-chloro-4-(oxolan-2-ylmethylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-(oxolan-2-ylmethylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136973800 |
| Molecular Formula | C9H12ClN3O2 |
| Molecular Weight | 229.67 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 5-chloro-4-(oxolan-2-ylmethylamino)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCC2CCCO2)c1Cl |
| InChI | InChI=1S/C9H12ClN3O2/c10-7-8(12-5-13-9(7)14)11-4-6-2-1-3-15-6/h5-6H,1-4H2,(H2,11,12,13,14) |
| InChIKey | DHVOCXYVZMBYIW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.67 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |