C8H14N4O2 — CID 136973934
5-amino-4-(1-hydroxybutan-2-ylamino)-1H-pyrimidin-6-one (PubChem CID 136973934) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is 5-amino-4-(1-hydroxybutan-2-ylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-(1-hydroxybutan-2-ylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136973934 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 5-amino-4-(1-hydroxybutan-2-ylamino)-1H-pyrimidin-6-one |
| SMILES | CCC(CO)Nc1nc[nH]c(=O)c1N |
| InChI | InChI=1S/C8H14N4O2/c1-2-5(3-13)12-7-6(9)8(14)11-4-10-7/h4-5,13H,2-3,9H2,1H3,(H2,10,11,12,14) |
| InChIKey | FCZWQKXGDVKRPF-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |