C8H10ClN3O3 — CID 136974095
ethyl 2-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]acetate (PubChem CID 136974095) has the molecular formula C8H10ClN3O3 and a molecular weight of 231.64 g/mol. Its IUPAC name is ethyl 2-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]acetate.
| Compound Name | ethyl 2-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]acetate |
|---|---|
| PubChem CID | 136974095 |
| Molecular Formula | C8H10ClN3O3 |
| Molecular Weight | 231.64 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | ethyl 2-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]acetate |
| SMILES | CCOC(=O)CNc1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C8H10ClN3O3/c1-2-15-5(13)3-10-7-6(9)8(14)12-4-11-7/h4H,2-3H2,1H3,(H2,10,11,12,14) |
| InChIKey | JWDFUFSUEUVOHU-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.64 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |