C15H15N5O — CID 136974643
2-methyl-4-[[4-(1H-pyrazol-5-yl)phenyl]methylamino]-1H-pyrimidin-6-one (PubChem CID 136974643) has the molecular formula C15H15N5O and a molecular weight of 281.32 g/mol. Its IUPAC name is 2-methyl-4-[[4-(1H-pyrazol-5-yl)phenyl]methylamino]-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-4-[[4-(1H-pyrazol-5-yl)phenyl]methylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136974643 |
| Molecular Formula | C15H15N5O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 2-methyl-4-[[4-(1H-pyrazol-5-yl)phenyl]methylamino]-1H-pyrimidin-6-one |
| SMILES | Cc1nc(NCc2ccc(-c3ccn[nH]3)cc2)cc(=O)[nH]1 |
| InChI | InChI=1S/C15H15N5O/c1-10-18-14(8-15(21)19-10)16-9-11-2-4-12(5-3-11)13-6-7-17-20-13/h2-8H,9H2,1H3,(H,17,20)(H2,16,18,19,21) |
| InChIKey | FBNVYQCKONMHLD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |