C11H19N3O3 — CID 136975426
4-[3-(hydroxymethyl)pentan-3-ylamino]-5-methoxy-1H-pyrimidin-6-one (PubChem CID 136975426) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is 4-[3-(hydroxymethyl)pentan-3-ylamino]-5-methoxy-1H-pyrimidin-6-one.
| Compound Name | 4-[3-(hydroxymethyl)pentan-3-ylamino]-5-methoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136975426 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 4-[3-(hydroxymethyl)pentan-3-ylamino]-5-methoxy-1H-pyrimidin-6-one |
| SMILES | CCC(CC)(CO)Nc1nc[nH]c(=O)c1OC |
| InChI | InChI=1S/C11H19N3O3/c1-4-11(5-2,6-15)14-9-8(17-3)10(16)13-7-12-9/h7,15H,4-6H2,1-3H3,(H2,12,13,14,16) |
| InChIKey | QQRXSTGWPLLSOM-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |