C9H12F3N3O — CID 136975602
2-ethyl-4-(3,3,3-trifluoropropylamino)-1H-pyrimidin-6-one (PubChem CID 136975602) has the molecular formula C9H12F3N3O and a molecular weight of 235.21 g/mol. Its IUPAC name is 2-ethyl-4-(3,3,3-trifluoropropylamino)-1H-pyrimidin-6-one.
| Compound Name | 2-ethyl-4-(3,3,3-trifluoropropylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136975602 |
| Molecular Formula | C9H12F3N3O |
| Molecular Weight | 235.21 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 2-ethyl-4-(3,3,3-trifluoropropylamino)-1H-pyrimidin-6-one |
| SMILES | CCc1nc(NCCC(F)(F)F)cc(=O)[nH]1 |
| InChI | InChI=1S/C9H12F3N3O/c1-2-6-14-7(5-8(16)15-6)13-4-3-9(10,11)12/h5H,2-4H2,1H3,(H2,13,14,15,16) |
| InChIKey | VTZALDKBYNMWID-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |