C10H14F3N3O — CID 136975606
2-propan-2-yl-4-(3,3,3-trifluoropropylamino)-1H-pyrimidin-6-one (PubChem CID 136975606) has the molecular formula C10H14F3N3O and a molecular weight of 249.24 g/mol. Its IUPAC name is 2-propan-2-yl-4-(3,3,3-trifluoropropylamino)-1H-pyrimidin-6-one.
| Compound Name | 2-propan-2-yl-4-(3,3,3-trifluoropropylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136975606 |
| Molecular Formula | C10H14F3N3O |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 2-propan-2-yl-4-(3,3,3-trifluoropropylamino)-1H-pyrimidin-6-one |
| SMILES | CC(C)c1nc(NCCC(F)(F)F)cc(=O)[nH]1 |
| InChI | InChI=1S/C10H14F3N3O/c1-6(2)9-15-7(5-8(17)16-9)14-4-3-10(11,12)13/h5-6H,3-4H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | OFPWERFQJZXOHR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |