About 5-methoxy-4-(3,3,3-trifluoropropylamino)-1H-pyrimidin-6-one
5-methoxy-4-(3,3,3-trifluoropropylamino)-1H-pyrimidin-6-one (PubChem CID 136975607) has the molecular formula C8H10F3N3O2
and a molecular weight of 237.18 g/mol. Its IUPAC name is 5-methoxy-4-(3,3,3-trifluoropropylamino)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-methoxy-4-(3,3,3-trifluoropropylamino)-1H-pyrimidin-6-one |
| PubChem CID | 136975607 |
| Molecular Formula | C8H10F3N3O2 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 5-methoxy-4-(3,3,3-trifluoropropylamino)-1H-pyrimidin-6-one |
| SMILES | COc1c(NCCC(F)(F)F)nc[nH]c1=O |
| InChI | InChI=1S/C8H10F3N3O2/c1-16-5-6(13-4-14-7(5)15)12-3-2-8(9,10)11/h4H,2-3H2,1H3,(H2,12,13,14,15) |
| InChIKey | KDNLBQAYEHSXKM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methoxy-4-(3,3,3-trifluoropropylamino)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-4-(3,3,3-trifluoropropylamino)-1H-pyrimidin-6-one?
The IUPAC name of 5-methoxy-4-(3,3,3-trifluoropropylamino)-1H-pyrimidin-6-one (CID 136975607) is 5-methoxy-4-(3,3,3-trifluoropropylamino)-1H-pyrimidin-6-one.
What is the SMILES notation for 5-methoxy-4-(3,3,3-trifluoropropylamino)-1H-pyrimidin-6-one?
The canonical SMILES for 5-methoxy-4-(3,3,3-trifluoropropylamino)-1H-pyrimidin-6-one is COc1c(NCCC(F)(F)F)nc[nH]c1=O.
What is the InChIKey of 5-methoxy-4-(3,3,3-trifluoropropylamino)-1H-pyrimidin-6-one?
The InChIKey is KDNLBQAYEHSXKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F3N3O2/c1-16-5-6(13-4-14-7(5)15)12-3-2-8(9,10)11/h4H,2-3H2,1H3,(H2,12,13,14,15).
What are the key properties of 5-methoxy-4-(3,3,3-trifluoropropylamino)-1H-pyrimidin-6-one?
5-methoxy-4-(3,3,3-trifluoropropylamino)-1H-pyrimidin-6-one has a molecular weight of 237.18 g/mol, XLogP of 1.14, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-4-(3,3,3-trifluoropropylamino)-1H-pyrimidin-6-one is sourced from PubChem (CID 136975607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).