C8H13N3O2S — CID 136975800
5-methoxy-4-(2-methylsulfanylethylamino)-1H-pyrimidin-6-one (PubChem CID 136975800) has the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. Its IUPAC name is 5-methoxy-4-(2-methylsulfanylethylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-methoxy-4-(2-methylsulfanylethylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136975800 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 5-methoxy-4-(2-methylsulfanylethylamino)-1H-pyrimidin-6-one |
| SMILES | COc1c(NCCSC)nc[nH]c1=O |
| InChI | InChI=1S/C8H13N3O2S/c1-13-6-7(9-3-4-14-2)10-5-11-8(6)12/h5H,3-4H2,1-2H3,(H2,9,10,11,12) |
| InChIKey | TTYJCRONAWHFAZ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|