C8H12ClN3O3S — CID 136976003
5-chloro-4-(1-methylsulfonylpropan-2-ylamino)-1H-pyrimidin-6-one (PubChem CID 136976003) has the molecular formula C8H12ClN3O3S and a molecular weight of 265.72 g/mol. Its IUPAC name is 5-chloro-4-(1-methylsulfonylpropan-2-ylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-(1-methylsulfonylpropan-2-ylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136976003 |
| Molecular Formula | C8H12ClN3O3S |
| Molecular Weight | 265.72 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 5-chloro-4-(1-methylsulfonylpropan-2-ylamino)-1H-pyrimidin-6-one |
| SMILES | CC(CS(C)(=O)=O)Nc1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C8H12ClN3O3S/c1-5(3-16(2,14)15)12-7-6(9)8(13)11-4-10-7/h4-5H,3H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | XKSGTPPIQGZJRZ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.72 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |