C14H21N3O2 — CID 136976032
2-cyclopropyl-4-[(2-hydroxycyclohexyl)methylamino]-1H-pyrimidin-6-one (PubChem CID 136976032) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-cyclopropyl-4-[(2-hydroxycyclohexyl)methylamino]-1H-pyrimidin-6-one.
| Compound Name | 2-cyclopropyl-4-[(2-hydroxycyclohexyl)methylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136976032 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 2-cyclopropyl-4-[(2-hydroxycyclohexyl)methylamino]-1H-pyrimidin-6-one |
| SMILES | O=c1cc(NCC2CCCCC2O)nc(C2CC2)[nH]1 |
| InChI | InChI=1S/C14H21N3O2/c18-11-4-2-1-3-10(11)8-15-12-7-13(19)17-14(16-12)9-5-6-9/h7,9-11,18H,1-6,8H2,(H2,15,16,17,19) |
| InChIKey | PEHBDTXGBLMPRB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |