C9H13F2N3O — CID 136976580
4-(2,2-difluoroethylamino)-2-propan-2-yl-1H-pyrimidin-6-one (PubChem CID 136976580) has the molecular formula C9H13F2N3O and a molecular weight of 217.22 g/mol. Its IUPAC name is 4-(2,2-difluoroethylamino)-2-propan-2-yl-1H-pyrimidin-6-one.
| Compound Name | 4-(2,2-difluoroethylamino)-2-propan-2-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136976580 |
| Molecular Formula | C9H13F2N3O |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 4-(2,2-difluoroethylamino)-2-propan-2-yl-1H-pyrimidin-6-one |
| SMILES | CC(C)c1nc(NCC(F)F)cc(=O)[nH]1 |
| InChI | InChI=1S/C9H13F2N3O/c1-5(2)9-13-7(3-8(15)14-9)12-4-6(10)11/h3,5-6H,4H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | ONBZJWYEVNYMOW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |