C12H16F3N3O — CID 136976593
2-cyclopropyl-4-(5,5,5-trifluoropentylamino)-1H-pyrimidin-6-one (PubChem CID 136976593) has the molecular formula C12H16F3N3O and a molecular weight of 275.27 g/mol. Its IUPAC name is 2-cyclopropyl-4-(5,5,5-trifluoropentylamino)-1H-pyrimidin-6-one.
| Compound Name | 2-cyclopropyl-4-(5,5,5-trifluoropentylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136976593 |
| Molecular Formula | C12H16F3N3O |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-cyclopropyl-4-(5,5,5-trifluoropentylamino)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(NCCCCC(F)(F)F)nc(C2CC2)[nH]1 |
| InChI | InChI=1S/C12H16F3N3O/c13-12(14,15)5-1-2-6-16-9-7-10(19)18-11(17-9)8-3-4-8/h7-8H,1-6H2,(H2,16,17,18,19) |
| InChIKey | WKAZGUZFUVLGFB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|