About 5-chloro-4-[(2,2-diethyloxan-4-yl)amino]-1H-pyrimidin-6-one
5-chloro-4-[(2,2-diethyloxan-4-yl)amino]-1H-pyrimidin-6-one (PubChem CID 136976693) has the molecular formula C13H20ClN3O2
and a molecular weight of 285.77 g/mol. Its IUPAC name is 5-chloro-4-[(2,2-diethyloxan-4-yl)amino]-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-chloro-4-[(2,2-diethyloxan-4-yl)amino]-1H-pyrimidin-6-one |
| PubChem CID | 136976693 |
| Molecular Formula | C13H20ClN3O2 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 5-chloro-4-[(2,2-diethyloxan-4-yl)amino]-1H-pyrimidin-6-one |
| SMILES | CCC1(CC)CC(Nc2nc[nH]c(=O)c2Cl)CCO1 |
| InChI | InChI=1S/C13H20ClN3O2/c1-3-13(4-2)7-9(5-6-19-13)17-11-10(14)12(18)16-8-15-11/h8-9H,3-7H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | PBHLNYLQPFNUDJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-4-[(2,2-diethyloxan-4-yl)amino]-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-[(2,2-diethyloxan-4-yl)amino]-1H-pyrimidin-6-one?
The IUPAC name of 5-chloro-4-[(2,2-diethyloxan-4-yl)amino]-1H-pyrimidin-6-one (CID 136976693) is 5-chloro-4-[(2,2-diethyloxan-4-yl)amino]-1H-pyrimidin-6-one.
What is the SMILES notation for 5-chloro-4-[(2,2-diethyloxan-4-yl)amino]-1H-pyrimidin-6-one?
The canonical SMILES for 5-chloro-4-[(2,2-diethyloxan-4-yl)amino]-1H-pyrimidin-6-one is CCC1(CC)CC(Nc2nc[nH]c(=O)c2Cl)CCO1.
What is the InChIKey of 5-chloro-4-[(2,2-diethyloxan-4-yl)amino]-1H-pyrimidin-6-one?
The InChIKey is PBHLNYLQPFNUDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20ClN3O2/c1-3-13(4-2)7-9(5-6-19-13)17-11-10(14)12(18)16-8-15-11/h8-9H,3-7H2,1-2H3,(H2,15,16,17,18).
What are the key properties of 5-chloro-4-[(2,2-diethyloxan-4-yl)amino]-1H-pyrimidin-6-one?
5-chloro-4-[(2,2-diethyloxan-4-yl)amino]-1H-pyrimidin-6-one has a molecular weight of 285.77 g/mol, XLogP of 2.57, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-[(2,2-diethyloxan-4-yl)amino]-1H-pyrimidin-6-one is sourced from PubChem (CID 136976693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).