About 4-[(2,2-diethyloxan-4-yl)amino]-5-methoxy-1H-pyrimidin-6-one
4-[(2,2-diethyloxan-4-yl)amino]-5-methoxy-1H-pyrimidin-6-one (PubChem CID 136976695) has the molecular formula C14H23N3O3
and a molecular weight of 281.36 g/mol. Its IUPAC name is 4-[(2,2-diethyloxan-4-yl)amino]-5-methoxy-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-[(2,2-diethyloxan-4-yl)amino]-5-methoxy-1H-pyrimidin-6-one |
| PubChem CID | 136976695 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 4-[(2,2-diethyloxan-4-yl)amino]-5-methoxy-1H-pyrimidin-6-one |
| SMILES | CCC1(CC)CC(Nc2nc[nH]c(=O)c2OC)CCO1 |
| InChI | InChI=1S/C14H23N3O3/c1-4-14(5-2)8-10(6-7-20-14)17-12-11(19-3)13(18)16-9-15-12/h9-10H,4-8H2,1-3H3,(H2,15,16,17,18) |
| InChIKey | GLIGLLDTGOCWLO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(2,2-diethyloxan-4-yl)amino]-5-methoxy-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,2-diethyloxan-4-yl)amino]-5-methoxy-1H-pyrimidin-6-one?
The IUPAC name of 4-[(2,2-diethyloxan-4-yl)amino]-5-methoxy-1H-pyrimidin-6-one (CID 136976695) is 4-[(2,2-diethyloxan-4-yl)amino]-5-methoxy-1H-pyrimidin-6-one.
What is the SMILES notation for 4-[(2,2-diethyloxan-4-yl)amino]-5-methoxy-1H-pyrimidin-6-one?
The canonical SMILES for 4-[(2,2-diethyloxan-4-yl)amino]-5-methoxy-1H-pyrimidin-6-one is CCC1(CC)CC(Nc2nc[nH]c(=O)c2OC)CCO1.
What is the InChIKey of 4-[(2,2-diethyloxan-4-yl)amino]-5-methoxy-1H-pyrimidin-6-one?
The InChIKey is GLIGLLDTGOCWLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O3/c1-4-14(5-2)8-10(6-7-20-14)17-12-11(19-3)13(18)16-9-15-12/h9-10H,4-8H2,1-3H3,(H2,15,16,17,18).
What are the key properties of 4-[(2,2-diethyloxan-4-yl)amino]-5-methoxy-1H-pyrimidin-6-one?
4-[(2,2-diethyloxan-4-yl)amino]-5-methoxy-1H-pyrimidin-6-one has a molecular weight of 281.36 g/mol, XLogP of 1.93, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,2-diethyloxan-4-yl)amino]-5-methoxy-1H-pyrimidin-6-one is sourced from PubChem (CID 136976695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).