C9H14N4O3 — CID 136976721
2-[(2-ethyl-6-oxo-1H-pyrimidin-4-yl)amino]ethyl carbamate (PubChem CID 136976721) has the molecular formula C9H14N4O3 and a molecular weight of 226.24 g/mol. Its IUPAC name is 2-[(2-ethyl-6-oxo-1H-pyrimidin-4-yl)amino]ethyl carbamate.
| Compound Name | 2-[(2-ethyl-6-oxo-1H-pyrimidin-4-yl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 136976721 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 2-[(2-ethyl-6-oxo-1H-pyrimidin-4-yl)amino]ethyl carbamate |
| SMILES | CCc1nc(NCCOC(N)=O)cc(=O)[nH]1 |
| InChI | InChI=1S/C9H14N4O3/c1-2-6-12-7(5-8(14)13-6)11-3-4-16-9(10)15/h5H,2-4H2,1H3,(H2,10,15)(H2,11,12,13,14) |
| InChIKey | AVZFIILMWSCEAM-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|