C12H21N3O4 — CID 136976953
5-methoxy-4-[4-(2-methoxyethoxy)butylamino]-1H-pyrimidin-6-one (PubChem CID 136976953) has the molecular formula C12H21N3O4 and a molecular weight of 271.32 g/mol. Its IUPAC name is 5-methoxy-4-[4-(2-methoxyethoxy)butylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-methoxy-4-[4-(2-methoxyethoxy)butylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136976953 |
| Molecular Formula | C12H21N3O4 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 5-methoxy-4-[4-(2-methoxyethoxy)butylamino]-1H-pyrimidin-6-one |
| SMILES | COCCOCCCCNc1nc[nH]c(=O)c1OC |
| InChI | InChI=1S/C12H21N3O4/c1-17-7-8-19-6-4-3-5-13-11-10(18-2)12(16)15-9-14-11/h9H,3-8H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | HKQLXNGGTWTIEP-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|