C9H11IN4O3 — CID 136978434
1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)piperazine-2-carboxylic acid (PubChem CID 136978434) has the molecular formula C9H11IN4O3 and a molecular weight of 350.12 g/mol. Its IUPAC name is 1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)piperazine-2-carboxylic acid.
| Compound Name | 1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 136978434 |
| Molecular Formula | C9H11IN4O3 |
| Molecular Weight | 350.12 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 1-(5-iodo-6-oxo-1H-pyrimidin-4-yl)piperazine-2-carboxylic acid |
| SMILES | O=C(O)C1CNCCN1c1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C9H11IN4O3/c10-6-7(12-4-13-8(6)15)14-2-1-11-3-5(14)9(16)17/h4-5,11H,1-3H2,(H,16,17)(H,12,13,15) |
| InChIKey | XLBQXHJXTQEZHI-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.12 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|