C12H19BrN4O — CID 136978631
4-[(4-aminocyclohexyl)-ethylamino]-5-bromo-1H-pyrimidin-6-one (PubChem CID 136978631) has the molecular formula C12H19BrN4O and a molecular weight of 315.22 g/mol. Its IUPAC name is 4-[(4-aminocyclohexyl)-ethylamino]-5-bromo-1H-pyrimidin-6-one.
| Compound Name | 4-[(4-aminocyclohexyl)-ethylamino]-5-bromo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136978631 |
| Molecular Formula | C12H19BrN4O |
| Molecular Weight | 315.22 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 4-[(4-aminocyclohexyl)-ethylamino]-5-bromo-1H-pyrimidin-6-one |
| SMILES | CCN(c1nc[nH]c(=O)c1Br)C1CCC(N)CC1 |
| InChI | InChI=1S/C12H19BrN4O/c1-2-17(9-5-3-8(14)4-6-9)11-10(13)12(18)16-7-15-11/h7-9H,2-6,14H2,1H3,(H,15,16,18) |
| InChIKey | MYPLYFPSJOURAM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |