C9H15N5O — CID 136978978
5-amino-4-[2-(aminomethyl)pyrrolidin-1-yl]-1H-pyrimidin-6-one (PubChem CID 136978978) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is 5-amino-4-[2-(aminomethyl)pyrrolidin-1-yl]-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-[2-(aminomethyl)pyrrolidin-1-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136978978 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 5-amino-4-[2-(aminomethyl)pyrrolidin-1-yl]-1H-pyrimidin-6-one |
| SMILES | NCC1CCCN1c1nc[nH]c(=O)c1N |
| InChI | InChI=1S/C9H15N5O/c10-4-6-2-1-3-14(6)8-7(11)9(15)13-5-12-8/h5-6H,1-4,10-11H2,(H,12,13,15) |
| InChIKey | XZECFWSCUKAPBV-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |