About 4-[(3-amino-2,2-difluoropropyl)amino]-5-methoxy-1H-pyrimidin-6-one
4-[(3-amino-2,2-difluoropropyl)amino]-5-methoxy-1H-pyrimidin-6-one (PubChem CID 136979148) has the molecular formula C8H12F2N4O2
and a molecular weight of 234.21 g/mol. Its IUPAC name is 4-[(3-amino-2,2-difluoropropyl)amino]-5-methoxy-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-[(3-amino-2,2-difluoropropyl)amino]-5-methoxy-1H-pyrimidin-6-one |
| PubChem CID | 136979148 |
| Molecular Formula | C8H12F2N4O2 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 4-[(3-amino-2,2-difluoropropyl)amino]-5-methoxy-1H-pyrimidin-6-one |
| SMILES | COc1c(NCC(F)(F)CN)nc[nH]c1=O |
| InChI | InChI=1S/C8H12F2N4O2/c1-16-5-6(13-4-14-7(5)15)12-3-8(9,10)2-11/h4H,2-3,11H2,1H3,(H2,12,13,14,15) |
| InChIKey | UTNPMTOPKUJRJA-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(3-amino-2,2-difluoropropyl)amino]-5-methoxy-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-amino-2,2-difluoropropyl)amino]-5-methoxy-1H-pyrimidin-6-one?
The IUPAC name of 4-[(3-amino-2,2-difluoropropyl)amino]-5-methoxy-1H-pyrimidin-6-one (CID 136979148) is 4-[(3-amino-2,2-difluoropropyl)amino]-5-methoxy-1H-pyrimidin-6-one.
What is the SMILES notation for 4-[(3-amino-2,2-difluoropropyl)amino]-5-methoxy-1H-pyrimidin-6-one?
The canonical SMILES for 4-[(3-amino-2,2-difluoropropyl)amino]-5-methoxy-1H-pyrimidin-6-one is COc1c(NCC(F)(F)CN)nc[nH]c1=O.
What is the InChIKey of 4-[(3-amino-2,2-difluoropropyl)amino]-5-methoxy-1H-pyrimidin-6-one?
The InChIKey is UTNPMTOPKUJRJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2N4O2/c1-16-5-6(13-4-14-7(5)15)12-3-8(9,10)2-11/h4H,2-3,11H2,1H3,(H2,12,13,14,15).
What are the key properties of 4-[(3-amino-2,2-difluoropropyl)amino]-5-methoxy-1H-pyrimidin-6-one?
4-[(3-amino-2,2-difluoropropyl)amino]-5-methoxy-1H-pyrimidin-6-one has a molecular weight of 234.21 g/mol, XLogP of -0.22, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-amino-2,2-difluoropropyl)amino]-5-methoxy-1H-pyrimidin-6-one is sourced from PubChem (CID 136979148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).