C14H17BrN4O — CID 136979290
4-[(2-aminophenyl)methyl-propylamino]-5-bromo-1H-pyrimidin-6-one (PubChem CID 136979290) has the molecular formula C14H17BrN4O and a molecular weight of 337.22 g/mol. Its IUPAC name is 4-[(2-aminophenyl)methyl-propylamino]-5-bromo-1H-pyrimidin-6-one.
| Compound Name | 4-[(2-aminophenyl)methyl-propylamino]-5-bromo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136979290 |
| Molecular Formula | C14H17BrN4O |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 4-[(2-aminophenyl)methyl-propylamino]-5-bromo-1H-pyrimidin-6-one |
| SMILES | CCCN(Cc1ccccc1N)c1nc[nH]c(=O)c1Br |
| InChI | InChI=1S/C14H17BrN4O/c1-2-7-19(8-10-5-3-4-6-11(10)16)13-12(15)14(20)18-9-17-13/h3-6,9H,2,7-8,16H2,1H3,(H,17,18,20) |
| InChIKey | BKFROLPVKHZZPI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|