C14H22N4O2 — CID 136979760
2-cyclopropyl-4-[2-[(dimethylamino)methyl]-4-hydroxypyrrolidin-1-yl]-1H-pyrimidin-6-one (PubChem CID 136979760) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 2-cyclopropyl-4-[2-[(dimethylamino)methyl]-4-hydroxypyrrolidin-1-yl]-1H-pyrimidin-6-one.
| Compound Name | 2-cyclopropyl-4-[2-[(dimethylamino)methyl]-4-hydroxypyrrolidin-1-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136979760 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2-cyclopropyl-4-[2-[(dimethylamino)methyl]-4-hydroxypyrrolidin-1-yl]-1H-pyrimidin-6-one |
| SMILES | CN(C)CC1CC(O)CN1c1cc(=O)[nH]c(C2CC2)n1 |
| InChI | InChI=1S/C14H22N4O2/c1-17(2)7-10-5-11(19)8-18(10)12-6-13(20)16-14(15-12)9-3-4-9/h6,9-11,19H,3-5,7-8H2,1-2H3,(H,15,16,20) |
| InChIKey | WVPWSNOJIFUNPB-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |