C10H14IN3O3 — CID 136979792
4-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136979792) has the molecular formula C10H14IN3O3 and a molecular weight of 351.14 g/mol. Its IUPAC name is 4-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136979792 |
| Molecular Formula | C10H14IN3O3 |
| Molecular Weight | 351.14 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 4-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CC1COC(CO)CN1c1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C10H14IN3O3/c1-6-4-17-7(3-15)2-14(6)9-8(11)10(16)13-5-12-9/h5-7,15H,2-4H2,1H3,(H,12,13,16) |
| InChIKey | SZXOURTXQUGJAN-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.14 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|