C12H19N3O4 — CID 136979802
4-[4-(2-hydroxyethoxy)piperidin-1-yl]-5-methoxy-1H-pyrimidin-6-one (PubChem CID 136979802) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is 4-[4-(2-hydroxyethoxy)piperidin-1-yl]-5-methoxy-1H-pyrimidin-6-one.
| Compound Name | 4-[4-(2-hydroxyethoxy)piperidin-1-yl]-5-methoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136979802 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 4-[4-(2-hydroxyethoxy)piperidin-1-yl]-5-methoxy-1H-pyrimidin-6-one |
| SMILES | COc1c(N2CCC(OCCO)CC2)nc[nH]c1=O |
| InChI | InChI=1S/C12H19N3O4/c1-18-10-11(13-8-14-12(10)17)15-4-2-9(3-5-15)19-7-6-16/h8-9,16H,2-7H2,1H3,(H,13,14,17) |
| InChIKey | OHHFFIXDQKJRGL-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 87.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |