C12H11N5O2 — CID 136979897
4-(6-aminoindazol-1-yl)-5-methoxy-1H-pyrimidin-6-one (PubChem CID 136979897) has the molecular formula C12H11N5O2 and a molecular weight of 257.25 g/mol. Its IUPAC name is 4-(6-aminoindazol-1-yl)-5-methoxy-1H-pyrimidin-6-one.
| Compound Name | 4-(6-aminoindazol-1-yl)-5-methoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136979897 |
| Molecular Formula | C12H11N5O2 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 4-(6-aminoindazol-1-yl)-5-methoxy-1H-pyrimidin-6-one |
| SMILES | COc1c(-n2ncc3ccc(N)cc32)nc[nH]c1=O |
| InChI | InChI=1S/C12H11N5O2/c1-19-10-11(14-6-15-12(10)18)17-9-4-8(13)3-2-7(9)5-16-17/h2-6H,13H2,1H3,(H,14,15,18) |
| InChIKey | FJFPSQGSTPRPRR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|