C16H17N7S — CID 136980219
5-[[3-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)piperidin-1-yl]methyl]-1,3-thiazole (PubChem CID 136980219) has the molecular formula C16H17N7S and a molecular weight of 339.43 g/mol. Its IUPAC name is 5-[[3-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)piperidin-1-yl]methyl]-1,3-thiazole.
| Compound Name | 5-[[3-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)piperidin-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 136980219 |
| Molecular Formula | C16H17N7S |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 5-[[3-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)piperidin-1-yl]methyl]-1,3-thiazole |
| SMILES | c1cc2c(ncn3nnc(C4CCCN(Cc5cncs5)C4)c23)[nH]1 |
| InChI | InChI=1S/C16H17N7S/c1-2-11(7-22(5-1)8-12-6-17-10-24-12)14-15-13-3-4-18-16(13)19-9-23(15)21-20-14/h3-4,6,9-11,18H,1-2,5,7-8H2 |
| InChIKey | FKXBAZKIIGGPFW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |