C20H21FN6O — CID 136980232
3-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]-4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 136980232) has the molecular formula C20H21FN6O and a molecular weight of 380.43 g/mol. Its IUPAC name is 3-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]-4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 3-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]-4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 136980232 |
| Molecular Formula | C20H21FN6O |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 3-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]-4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | COc1ccc(CN2CCC(c3nnn4cnc5[nH]ccc5c34)CC2)cc1F |
| InChI | InChI=1S/C20H21FN6O/c1-28-17-3-2-13(10-16(17)21)11-26-8-5-14(6-9-26)18-19-15-4-7-22-20(15)23-12-27(19)25-24-18/h2-4,7,10,12,14,22H,5-6,8-9,11H2,1H3 |
| InChIKey | RKAHZMDQIBZXPH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |