C22H23F3N6O — CID 136980250
2-methyl-N-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methyl]-4-(trifluoromethoxy)aniline (PubChem CID 136980250) has the molecular formula C22H23F3N6O and a molecular weight of 444.46 g/mol. Its IUPAC name is 2-methyl-N-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methyl]-4-(trifluoromethoxy)aniline.
| Compound Name | 2-methyl-N-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methyl]-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 136980250 |
| Molecular Formula | C22H23F3N6O |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 2-methyl-N-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]methyl]-4-(trifluoromethoxy)aniline |
| SMILES | Cc1cc(OC(F)(F)F)ccc1NCC1CCC(c2nnn3cnc4[nH]ccc4c23)CC1 |
| InChI | InChI=1S/C22H23F3N6O/c1-13-10-16(32-22(23,24)25)6-7-18(13)27-11-14-2-4-15(5-3-14)19-20-17-8-9-26-21(17)28-12-31(20)30-29-19/h6-10,12,14-15,26-27H,2-5,11H2,1H3 |
| InChIKey | LLHSUQXXDPGCBL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|