C18H17N7S — CID 136980264
5-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)piperidin-1-yl]methyl]thiophene-2-carbonitrile (PubChem CID 136980264) has the molecular formula C18H17N7S and a molecular weight of 363.45 g/mol. Its IUPAC name is 5-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)piperidin-1-yl]methyl]thiophene-2-carbonitrile.
| Compound Name | 5-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)piperidin-1-yl]methyl]thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 136980264 |
| Molecular Formula | C18H17N7S |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 5-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)piperidin-1-yl]methyl]thiophene-2-carbonitrile |
| SMILES | N#Cc1ccc(CN2CCC(c3nnn4cnc5[nH]ccc5c34)CC2)s1 |
| InChI | InChI=1S/C18H17N7S/c19-9-13-1-2-14(26-13)10-24-7-4-12(5-8-24)16-17-15-3-6-20-18(15)21-11-25(17)23-22-16/h1-3,6,11-12,20H,4-5,7-8,10H2 |
| InChIKey | GLTHTYRWIILEGV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 85.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |