C20H20F3N3O — CID 136980444
(4R)-3,7,7-trimethyl-4-phenyl-4-(trifluoromethyl)-2,6,8,9-tetrahydropyrazolo[3,4-b]quinolin-5-one (PubChem CID 136980444) has the molecular formula C20H20F3N3O and a molecular weight of 375.39 g/mol. Its IUPAC name is (4R)-3,7,7-trimethyl-4-phenyl-4-(trifluoromethyl)-2,6,8,9-tetrahydropyrazolo[3,4-b]quinolin-5-one.
| Compound Name | (4R)-3,7,7-trimethyl-4-phenyl-4-(trifluoromethyl)-2,6,8,9-tetrahydropyrazolo[3,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 136980444 |
| Molecular Formula | C20H20F3N3O |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | (4R)-3,7,7-trimethyl-4-phenyl-4-(trifluoromethyl)-2,6,8,9-tetrahydropyrazolo[3,4-b]quinolin-5-one |
| SMILES | Cc1[nH]nc2c1[C@@](c1ccccc1)(C(F)(F)F)C1=C(CC(C)(C)CC1=O)N2 |
| InChI | InChI=1S/C20H20F3N3O/c1-11-15-17(26-25-11)24-13-9-18(2,3)10-14(27)16(13)19(15,20(21,22)23)12-7-5-4-6-8-12/h4-8H,9-10H2,1-3H3,(H2,24,25,26)/t19-/m1/s1 |
| InChIKey | GJVBBWLZZPTAFY-LJQANCHMSA-N |
| XLogP | 4.64 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |