C22H22F3N3O — CID 136980447
3-cyclopropyl-7,7-dimethyl-4-phenyl-4-(trifluoromethyl)-2,6,8,9-tetrahydropyrazolo[3,4-b]quinolin-5-one (PubChem CID 136980447) has the molecular formula C22H22F3N3O and a molecular weight of 401.43 g/mol. Its IUPAC name is 3-cyclopropyl-7,7-dimethyl-4-phenyl-4-(trifluoromethyl)-2,6,8,9-tetrahydropyrazolo[3,4-b]quinolin-5-one.
| Compound Name | 3-cyclopropyl-7,7-dimethyl-4-phenyl-4-(trifluoromethyl)-2,6,8,9-tetrahydropyrazolo[3,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 136980447 |
| Molecular Formula | C22H22F3N3O |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 3-cyclopropyl-7,7-dimethyl-4-phenyl-4-(trifluoromethyl)-2,6,8,9-tetrahydropyrazolo[3,4-b]quinolin-5-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1n[nH]c(C3CC3)c1C2(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C22H22F3N3O/c1-20(2)10-14-16(15(29)11-20)21(22(23,24)25,13-6-4-3-5-7-13)17-18(12-8-9-12)27-28-19(17)26-14/h3-7,12H,8-11H2,1-2H3,(H2,26,27,28) |
| InChIKey | YLTKXKQDPHERSK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |