C16H19F3N6O2S — CID 136980499
1-[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]-N-(2,2,2-trifluoroethyl)methanesulfonamide (PubChem CID 136980499) has the molecular formula C16H19F3N6O2S and a molecular weight of 416.43 g/mol. Its IUPAC name is 1-[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]-N-(2,2,2-trifluoroethyl)methanesulfonamide.
| Compound Name | 1-[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]-N-(2,2,2-trifluoroethyl)methanesulfonamide |
|---|---|
| PubChem CID | 136980499 |
| Molecular Formula | C16H19F3N6O2S |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 1-[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]-N-(2,2,2-trifluoroethyl)methanesulfonamide |
| SMILES | O=S(=O)(CC1CCC(c2nnn3cnc4[nH]ccc4c23)CC1)NCC(F)(F)F |
| InChI | InChI=1S/C16H19F3N6O2S/c17-16(18,19)8-22-28(26,27)7-10-1-3-11(4-2-10)13-14-12-5-6-20-15(12)21-9-25(14)24-23-13/h5-6,9-11,20,22H,1-4,7-8H2 |
| InChIKey | RFBHCAPWFBMMIB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |