C22H22ClF3N6O — CID 136980503
2-(4-chlorophenyl)-1,1,1-trifluoro-3-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]amino]propan-2-ol (PubChem CID 136980503) has the molecular formula C22H22ClF3N6O and a molecular weight of 478.91 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1,1,1-trifluoro-3-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]amino]propan-2-ol.
| Compound Name | 2-(4-chlorophenyl)-1,1,1-trifluoro-3-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 136980503 |
| Molecular Formula | C22H22ClF3N6O |
| Molecular Weight | 478.91 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 2-(4-chlorophenyl)-1,1,1-trifluoro-3-[[4-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)cyclohexyl]amino]propan-2-ol |
| SMILES | OC(CNC1CCC(c2nnn3cnc4[nH]ccc4c23)CC1)(c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C22H22ClF3N6O/c23-15-5-3-14(4-6-15)21(33,22(24,25)26)11-28-16-7-1-13(2-8-16)18-19-17-9-10-27-20(17)29-12-32(19)31-30-18/h3-6,9-10,12-13,16,27-28,33H,1-2,7-8,11H2 |
| InChIKey | BPTGCASMEHPBQD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.91 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |