About 6H-[1,2]oxazolo[4,5-g][1]benzazepine
6H-[1,2]oxazolo[4,5-g][1]benzazepine (PubChem CID 136980671) has the molecular formula C11H8N2O
and a molecular weight of 184.20 g/mol. Its IUPAC name is 6H-[1,2]oxazolo[4,5-g][1]benzazepine.
Molecular Properties
| Compound Name | 6H-[1,2]oxazolo[4,5-g][1]benzazepine |
| PubChem CID | 136980671 |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 6H-[1,2]oxazolo[4,5-g][1]benzazepine |
| SMILES | C1=CNc2ccc3oncc3c2C=C1 |
| InChI | InChI=1S/C11H8N2O/c1-2-6-12-10-4-5-11-9(7-13-14-11)8(10)3-1/h1-7,12H |
| InChIKey | LEHOOXZOXQWYPJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6H-[1,2]oxazolo[4,5-g][1]benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-[1,2]oxazolo[4,5-g][1]benzazepine?
The IUPAC name of 6H-[1,2]oxazolo[4,5-g][1]benzazepine (CID 136980671) is 6H-[1,2]oxazolo[4,5-g][1]benzazepine.
What is the SMILES notation for 6H-[1,2]oxazolo[4,5-g][1]benzazepine?
The canonical SMILES for 6H-[1,2]oxazolo[4,5-g][1]benzazepine is C1=CNc2ccc3oncc3c2C=C1.
What is the InChIKey of 6H-[1,2]oxazolo[4,5-g][1]benzazepine?
The InChIKey is LEHOOXZOXQWYPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O/c1-2-6-12-10-4-5-11-9(7-13-14-11)8(10)3-1/h1-7,12H.
What are the key properties of 6H-[1,2]oxazolo[4,5-g][1]benzazepine?
6H-[1,2]oxazolo[4,5-g][1]benzazepine has a molecular weight of 184.20 g/mol, XLogP of 2.78, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-[1,2]oxazolo[4,5-g][1]benzazepine is sourced from PubChem (CID 136980671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).