C21H26N6O2 — CID 136981041
11-(4-hydroxybutyl)-8,11,14,18,19,22-hexazatetracyclo[13.5.2.12,6.018,21]tricosa-1(21),2(23),3,5,15(22),16,19-heptaen-7-one (PubChem CID 136981041) has the molecular formula C21H26N6O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is 11-(4-hydroxybutyl)-8,11,14,18,19,22-hexazatetracyclo[13.5.2.12,6.018,21]tricosa-1(21),2(23),3,5,15(22),16,19-heptaen-7-one.
| Compound Name | 11-(4-hydroxybutyl)-8,11,14,18,19,22-hexazatetracyclo[13.5.2.12,6.018,21]tricosa-1(21),2(23),3,5,15(22),16,19-heptaen-7-one |
|---|---|
| PubChem CID | 136981041 |
| Molecular Formula | C21H26N6O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 11-(4-hydroxybutyl)-8,11,14,18,19,22-hexazatetracyclo[13.5.2.12,6.018,21]tricosa-1(21),2(23),3,5,15(22),16,19-heptaen-7-one |
| SMILES | O=C1NCCN(CCCCO)CCNc2ccn3ncc(c3n2)-c2cccc1c2 |
| InChI | InChI=1S/C21H26N6O2/c28-13-2-1-9-26-11-7-22-19-6-10-27-20(25-19)18(15-24-27)16-4-3-5-17(14-16)21(29)23-8-12-26/h3-6,10,14-15,28H,1-2,7-9,11-13H2,(H,22,25)(H,23,29) |
| InChIKey | NCWLKVSIUAMSQI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 94.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|