C13H14IN3O2 — CID 136981205
5-iodo-4-[2-(2-methoxyethyl)anilino]-1H-pyrimidin-6-one (PubChem CID 136981205) has the molecular formula C13H14IN3O2 and a molecular weight of 371.18 g/mol. Its IUPAC name is 5-iodo-4-[2-(2-methoxyethyl)anilino]-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-[2-(2-methoxyethyl)anilino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136981205 |
| Molecular Formula | C13H14IN3O2 |
| Molecular Weight | 371.18 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 5-iodo-4-[2-(2-methoxyethyl)anilino]-1H-pyrimidin-6-one |
| SMILES | COCCc1ccccc1Nc1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C13H14IN3O2/c1-19-7-6-9-4-2-3-5-10(9)17-12-11(14)13(18)16-8-15-12/h2-5,8H,6-7H2,1H3,(H2,15,16,17,18) |
| InChIKey | SXIFQUUZZRUCKL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.18 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|