C25H32N2O4 — CID 136981593
tert-butyl (4aR,8S,8aS)-5-[6-(2-hydroxy-3-methylphenyl)-2-pyridinyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyridine-8-carboxylate (PubChem CID 136981593) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is tert-butyl (4aR,8S,8aS)-5-[6-(2-hydroxy-3-methylphenyl)-2-pyridinyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyridine-8-carboxylate.
| Compound Name | tert-butyl (4aR,8S,8aS)-5-[6-(2-hydroxy-3-methylphenyl)-2-pyridinyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyridine-8-carboxylate |
|---|---|
| PubChem CID | 136981593 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | tert-butyl (4aR,8S,8aS)-5-[6-(2-hydroxy-3-methylphenyl)-2-pyridinyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyridine-8-carboxylate |
| SMILES | Cc1cccc(-c2cccc(N3CC[C@H](C(=O)OC(C)(C)C)[C@@H]4OCCC[C@H]43)n2)c1O |
| InChI | InChI=1S/C25H32N2O4/c1-16-8-5-9-17(22(16)28)19-10-6-12-21(26-19)27-14-13-18(24(29)31-25(2,3)4)23-20(27)11-7-15-30-23/h5-6,8-10,12,18,20,23,28H,7,11,13-15H2,1-4H3/t18-,20+,23-/m0/s1 |
| InChIKey | CSCAQZUIZAMTAF-NOXFTYBFSA-N |
| XLogP | 4.48 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |