C15H16F6N6S — CID 136981899
6-(3,3-difluorocyclobutyl)-2-(3,3-difluorocyclobutyl)imino-6-[4-(difluoromethyl)-1,3-thiazol-2-yl]-1,3-dihydro-1,3,5-triazin-4-amine (PubChem CID 136981899) has the molecular formula C15H16F6N6S and a molecular weight of 426.39 g/mol. Its IUPAC name is 6-(3,3-difluorocyclobutyl)-2-(3,3-difluorocyclobutyl)imino-6-[4-(difluoromethyl)-1,3-thiazol-2-yl]-1,3-dihydro-1,3,5-triazin-4-amine.
| Compound Name | 6-(3,3-difluorocyclobutyl)-2-(3,3-difluorocyclobutyl)imino-6-[4-(difluoromethyl)-1,3-thiazol-2-yl]-1,3-dihydro-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 136981899 |
| Molecular Formula | C15H16F6N6S |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 6-(3,3-difluorocyclobutyl)-2-(3,3-difluorocyclobutyl)imino-6-[4-(difluoromethyl)-1,3-thiazol-2-yl]-1,3-dihydro-1,3,5-triazin-4-amine |
| SMILES | NC1=NC(c2nc(C(F)F)cs2)(C2CC(F)(F)C2)N/C(=N/C2CC(F)(F)C2)N1 |
| InChI | InChI=1S/C15H16F6N6S/c16-9(17)8-5-28-10(24-8)15(6-1-13(18,19)2-6)26-11(22)25-12(27-15)23-7-3-14(20,21)4-7/h5-7,9H,1-4H2,(H4,22,23,25,26,27) |
| InChIKey | AXVHSCAJXXUBGT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|