C16H18F6N6S — CID 136981917
6-(3,3-difluorocyclobutyl)-2-(3,3-difluorocyclobutyl)imino-6-[2-(1,1-difluoroethyl)-1,3-thiazol-4-yl]-1,3-dihydro-1,3,5-triazin-4-amine (PubChem CID 136981917) has the molecular formula C16H18F6N6S and a molecular weight of 440.42 g/mol. Its IUPAC name is 6-(3,3-difluorocyclobutyl)-2-(3,3-difluorocyclobutyl)imino-6-[2-(1,1-difluoroethyl)-1,3-thiazol-4-yl]-1,3-dihydro-1,3,5-triazin-4-amine.
| Compound Name | 6-(3,3-difluorocyclobutyl)-2-(3,3-difluorocyclobutyl)imino-6-[2-(1,1-difluoroethyl)-1,3-thiazol-4-yl]-1,3-dihydro-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 136981917 |
| Molecular Formula | C16H18F6N6S |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 6-(3,3-difluorocyclobutyl)-2-(3,3-difluorocyclobutyl)imino-6-[2-(1,1-difluoroethyl)-1,3-thiazol-4-yl]-1,3-dihydro-1,3,5-triazin-4-amine |
| SMILES | CC(F)(F)c1nc(C2(C3CC(F)(F)C3)N=C(N)N/C(=N\C3CC(F)(F)C3)N2)cs1 |
| InChI | InChI=1S/C16H18F6N6S/c1-13(17,18)10-25-9(6-29-10)16(7-2-14(19,20)3-7)27-11(23)26-12(28-16)24-8-4-15(21,22)5-8/h6-8H,2-5H2,1H3,(H4,23,24,26,27,28) |
| InChIKey | PYAKCKWIYGACDQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|