C19H24F7N7 — CID 136981921
6-(4,4-difluorocyclohexyl)-2-(4,4-difluorocyclohexyl)imino-6-[3-(trifluoromethyl)pyrazol-1-yl]-1,3-dihydro-1,3,5-triazin-4-amine (PubChem CID 136981921) has the molecular formula C19H24F7N7 and a molecular weight of 483.44 g/mol. Its IUPAC name is 6-(4,4-difluorocyclohexyl)-2-(4,4-difluorocyclohexyl)imino-6-[3-(trifluoromethyl)pyrazol-1-yl]-1,3-dihydro-1,3,5-triazin-4-amine.
| Compound Name | 6-(4,4-difluorocyclohexyl)-2-(4,4-difluorocyclohexyl)imino-6-[3-(trifluoromethyl)pyrazol-1-yl]-1,3-dihydro-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 136981921 |
| Molecular Formula | C19H24F7N7 |
| Molecular Weight | 483.44 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 6-(4,4-difluorocyclohexyl)-2-(4,4-difluorocyclohexyl)imino-6-[3-(trifluoromethyl)pyrazol-1-yl]-1,3-dihydro-1,3,5-triazin-4-amine |
| SMILES | NC1=NC(C2CCC(F)(F)CC2)(n2ccc(C(F)(F)F)n2)N/C(=N/C2CCC(F)(F)CC2)N1 |
| InChI | InChI=1S/C19H24F7N7/c20-16(21)6-1-11(2-7-16)19(33-10-5-13(32-33)18(24,25)26)30-14(27)29-15(31-19)28-12-3-8-17(22,23)9-4-12/h5,10-12H,1-4,6-9H2,(H4,27,28,29,30,31) |
| InChIKey | RAUQQGMQRDENCT-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|