C20H26F6N6S — CID 136981922
6-(4,4-difluorocyclohexyl)-2-(4,4-difluorocyclohexyl)imino-6-[2-(1,1-difluoroethyl)-1,3-thiazol-4-yl]-1,3-dihydro-1,3,5-triazin-4-amine (PubChem CID 136981922) has the molecular formula C20H26F6N6S and a molecular weight of 496.53 g/mol. Its IUPAC name is 6-(4,4-difluorocyclohexyl)-2-(4,4-difluorocyclohexyl)imino-6-[2-(1,1-difluoroethyl)-1,3-thiazol-4-yl]-1,3-dihydro-1,3,5-triazin-4-amine.
| Compound Name | 6-(4,4-difluorocyclohexyl)-2-(4,4-difluorocyclohexyl)imino-6-[2-(1,1-difluoroethyl)-1,3-thiazol-4-yl]-1,3-dihydro-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 136981922 |
| Molecular Formula | C20H26F6N6S |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 6-(4,4-difluorocyclohexyl)-2-(4,4-difluorocyclohexyl)imino-6-[2-(1,1-difluoroethyl)-1,3-thiazol-4-yl]-1,3-dihydro-1,3,5-triazin-4-amine |
| SMILES | CC(F)(F)c1nc(C2(C3CCC(F)(F)CC3)N=C(N)N/C(=N\C3CCC(F)(F)CC3)N2)cs1 |
| InChI | InChI=1S/C20H26F6N6S/c1-17(21,22)14-29-13(10-33-14)20(11-2-6-18(23,24)7-3-11)31-15(27)30-16(32-20)28-12-4-8-19(25,26)9-5-12/h10-12H,2-9H2,1H3,(H4,27,28,30,31,32) |
| InChIKey | WRSNKTDCXIZMMO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|