About 4-[4-(3-aminopropyl)-4,5-dihydro-1,3-oxazol-2-yl]phenol
4-[4-(3-aminopropyl)-4,5-dihydro-1,3-oxazol-2-yl]phenol (PubChem CID 136982327) has the molecular formula C12H16N2O2
and a molecular weight of 220.27 g/mol. Its IUPAC name is 4-[4-(3-aminopropyl)-4,5-dihydro-1,3-oxazol-2-yl]phenol.
Molecular Properties
| Compound Name | 4-[4-(3-aminopropyl)-4,5-dihydro-1,3-oxazol-2-yl]phenol |
| PubChem CID | 136982327 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 4-[4-(3-aminopropyl)-4,5-dihydro-1,3-oxazol-2-yl]phenol |
| SMILES | NCCCC1COC(c2ccc(O)cc2)=N1 |
| InChI | InChI=1S/C12H16N2O2/c13-7-1-2-10-8-16-12(14-10)9-3-5-11(15)6-4-9/h3-6,10,15H,1-2,7-8,13H2 |
| InChIKey | CYAAZIUAZLBEEC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-(3-aminopropyl)-4,5-dihydro-1,3-oxazol-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(3-aminopropyl)-4,5-dihydro-1,3-oxazol-2-yl]phenol?
The IUPAC name of 4-[4-(3-aminopropyl)-4,5-dihydro-1,3-oxazol-2-yl]phenol (CID 136982327) is 4-[4-(3-aminopropyl)-4,5-dihydro-1,3-oxazol-2-yl]phenol.
What is the SMILES notation for 4-[4-(3-aminopropyl)-4,5-dihydro-1,3-oxazol-2-yl]phenol?
The canonical SMILES for 4-[4-(3-aminopropyl)-4,5-dihydro-1,3-oxazol-2-yl]phenol is NCCCC1COC(c2ccc(O)cc2)=N1.
What is the InChIKey of 4-[4-(3-aminopropyl)-4,5-dihydro-1,3-oxazol-2-yl]phenol?
The InChIKey is CYAAZIUAZLBEEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2/c13-7-1-2-10-8-16-12(14-10)9-3-5-11(15)6-4-9/h3-6,10,15H,1-2,7-8,13H2.
What are the key properties of 4-[4-(3-aminopropyl)-4,5-dihydro-1,3-oxazol-2-yl]phenol?
4-[4-(3-aminopropyl)-4,5-dihydro-1,3-oxazol-2-yl]phenol has a molecular weight of 220.27 g/mol, XLogP of 1.28, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(3-aminopropyl)-4,5-dihydro-1,3-oxazol-2-yl]phenol is sourced from PubChem (CID 136982327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).