C47H67N13O2 — CID 136982469
2-ethylhexyl 3-[[5-amino-1-[4-[5-amino-3-tert-butyl-4-[[3-(3-ethylheptyl)phenyl]diazenyl]pyrazol-1-yl]-1,3,5-triazin-2-yl]-3-tert-butylpyrazol-4-yl]diazenyl]benzoate (PubChem CID 136982469) has the molecular formula C47H67N13O2 and a molecular weight of 846.14 g/mol. Its IUPAC name is 2-ethylhexyl 3-[[5-amino-1-[4-[5-amino-3-tert-butyl-4-[[3-(3-ethylheptyl)phenyl]diazenyl]pyrazol-1-yl]-1,3,5-triazin-2-yl]-3-tert-butylpyrazol-4-yl]diazenyl]benzoate.
| Compound Name | 2-ethylhexyl 3-[[5-amino-1-[4-[5-amino-3-tert-butyl-4-[[3-(3-ethylheptyl)phenyl]diazenyl]pyrazol-1-yl]-1,3,5-triazin-2-yl]-3-tert-butylpyrazol-4-yl]diazenyl]benzoate |
|---|---|
| PubChem CID | 136982469 |
| Molecular Formula | C47H67N13O2 |
| Molecular Weight | 846.14 g/mol |
| Exact Mass | 845.55 |
| IUPAC Name | 2-ethylhexyl 3-[[5-amino-1-[4-[5-amino-3-tert-butyl-4-[[3-(3-ethylheptyl)phenyl]diazenyl]pyrazol-1-yl]-1,3,5-triazin-2-yl]-3-tert-butylpyrazol-4-yl]diazenyl]benzoate |
| SMILES | CCCCC(CC)CCc1cccc(/N=N/c2c(C(C)(C)C)nn(-c3ncnc(-n4nc(C(C)(C)C)c(/N=N/c5cccc(C(=O)OCC(CC)CCCC)c5)c4N)n3)c2N)c1 |
| InChI | InChI=1S/C47H67N13O2/c1-11-15-19-31(13-3)25-26-33-21-17-23-35(27-33)53-55-37-39(46(5,6)7)57-59(41(37)48)44-50-30-51-45(52-44)60-42(49)38(40(58-60)47(8,9)10)56-54-36-24-18-22-34(28-36)43(61)62-29-32(14-4)20-16-12-2/h17-18,21-24,27-28,30-32H,11-16,19-20,25-26,29,48-49H2,1-10H3/b55-53+,56-54+ |
| InChIKey | AXXHRLHWUILIJK-DSZBTAPASA-N |
| XLogP | 12.36 |
| TPSA | 202.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.14 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|