C16H28N2S — CID 136985064
4,4-dimethyl-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-1,3-thiazinan-2-imine (PubChem CID 136985064) has the molecular formula C16H28N2S and a molecular weight of 280.48 g/mol. Its IUPAC name is 4,4-dimethyl-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-1,3-thiazinan-2-imine.
| Compound Name | 4,4-dimethyl-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136985064 |
| Molecular Formula | C16H28N2S |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 4,4-dimethyl-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-1,3-thiazinan-2-imine |
| SMILES | CC1(C)CCS/C(=N\C2C3(C)CCC(C3)C2(C)C)N1 |
| InChI | InChI=1S/C16H28N2S/c1-14(2)8-9-19-13(18-14)17-12-15(3,4)11-6-7-16(12,5)10-11/h11-12H,6-10H2,1-5H3,(H,17,18) |
| InChIKey | YBEVTMGBQAQLBJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|