C26H27N5O4 — CID 136985295
(E)-3-[4-[[4-ethoxy-3-(3-ethyl-1-methyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]methyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 136985295) has the molecular formula C26H27N5O4 and a molecular weight of 473.53 g/mol. Its IUPAC name is (E)-3-[4-[[4-ethoxy-3-(3-ethyl-1-methyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]methyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[4-[[4-ethoxy-3-(3-ethyl-1-methyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]methyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 136985295 |
| Molecular Formula | C26H27N5O4 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | (E)-3-[4-[[4-ethoxy-3-(3-ethyl-1-methyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]methyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | CCOc1ccc(Cc2ccc(/C=C/C(=O)NO)cc2)cc1-c1nc2c(CC)nn(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C26H27N5O4/c1-4-20-23-24(31(3)29-20)26(33)28-25(27-23)19-15-18(10-12-21(19)35-5-2)14-17-8-6-16(7-9-17)11-13-22(32)30-34/h6-13,15,34H,4-5,14H2,1-3H3,(H,30,32)(H,27,28,33)/b13-11+ |
| InChIKey | WAMOQJZIWYTENL-ACCUITESSA-N |
| XLogP | 3.39 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|