C12H12F3N3O5 — CID 136985320
7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(trifluoromethyl)-3H-pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 136985320) has the molecular formula C12H12F3N3O5 and a molecular weight of 335.24 g/mol. Its IUPAC name is 7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(trifluoromethyl)-3H-pyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(trifluoromethyl)-3H-pyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136985320 |
| Molecular Formula | C12H12F3N3O5 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(trifluoromethyl)-3H-pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2c1c(C(F)(F)F)cn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H12F3N3O5/c13-12(14,15)4-1-18(9-6(4)10(22)17-3-16-9)11-8(21)7(20)5(2-19)23-11/h1,3,5,7-8,11,19-21H,2H2,(H,16,17,22)/t5-,7-,8-,11-/m1/s1 |
| InChIKey | RVNZKGAWOCXFEK-IOSLPCCCSA-N |
| XLogP | -0.65 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |