C11H8FN3O — CID 136986148
5-(7-fluoro-1H-indol-3-yl)-1,2-oxazol-4-amine (PubChem CID 136986148) has the molecular formula C11H8FN3O and a molecular weight of 217.20 g/mol. Its IUPAC name is 5-(7-fluoro-1H-indol-3-yl)-1,2-oxazol-4-amine.
| Compound Name | 5-(7-fluoro-1H-indol-3-yl)-1,2-oxazol-4-amine |
|---|---|
| PubChem CID | 136986148 |
| Molecular Formula | C11H8FN3O |
| Molecular Weight | 217.20 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 5-(7-fluoro-1H-indol-3-yl)-1,2-oxazol-4-amine |
| SMILES | Nc1cnoc1-c1c[nH]c2c(F)cccc12 |
| InChI | InChI=1S/C11H8FN3O/c12-8-3-1-2-6-7(4-14-10(6)8)11-9(13)5-15-16-11/h1-5,14H,13H2 |
| InChIKey | FCINBPVHISJMHI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.20 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |